What is the 2-Methoxy-5-nitrophenol sodium salt?

2-Methoxy-5-nitrophenol sodium salt is red crystal, while it's Molecular Formula is C7H7NO4·Na. red crystal Sodium 5-nitroguaiacol is the most active monomer in sodium nitrophenolate, and has been designated and recommended as a green food engineering plant growth regulator by the United Nations and the Food and Agriculture Organization (FAO). It has a very obvious synergistic effect in the compounding of fertilizers, pesticides, fungicides, and seed coating agents; when applied in animal husbandry and fishery, it can significantly improve the yield and quality of meat, eggs and skins, and also It can enhance the immunity of animals and prevent various diseases.

What is the CAS number for 2-Methoxy-5-nitrophenol sodium salt?

The CAS number of 2-Methoxy-5-nitrophenol sodium salt is 67233-85-6.

What is 2-Methoxy-5-nitrophenol sodium salt (67233-85-6) used for?

2-Methoxy-5-nitrophenol sodium salt, also known as Sodium 5-nitroguaiacol, is a chemical compound derived from the sodium nitrophenolate family. It is recognized for its significant role as a green food engineering plant growth regulator, as endorsed by the United Nations and the Food and Agriculture Organization (FAO). 2-Methoxy-5-nitrophenol sodium salt is characterized by its solubility in various organic solvents such as methanol, ethanol, and acetone, and its ability to be compounded with other sodium nitrophenolates to form sodium nitrophenolate, which finds broad applications in the agricultural sector.InChI:InChI=1/C7H7NO4.Na/c1-12-7-3-2-5(8(10)11)4-6(7)9;/h2-4,9H,1H3;/q;+1/p-1

What is the 2-Methoxy-5-nitrophenol sodium salt?

2-Methoxy-5-nitrophenol sodium salt is red crystal, while it's Molecular Formula is C7H7NO4·Na. red crystal Sodium 5-nitroguaiacol is the most active monomer in sodium nitrophenolate, and has been designated and recommended as a green food engineering plant growth regulator by the United Nations and the Food and Agriculture Organization (FAO). It has a very obvious synergistic effect in the compounding of fertilizers, pesticides, fungicides, and seed coating agents; when applied in animal husbandry and fishery, it can significantly improve the yield and quality of meat, eggs and skins, and also It can enhance the immunity of animals and prevent various diseases.

What is the CAS number for 2-Methoxy-5-nitrophenol sodium salt?

The CAS number of 2-Methoxy-5-nitrophenol sodium salt is 67233-85-6.

What is 2-Methoxy-5-nitrophenol sodium salt (67233-85-6) used for?

2-Methoxy-5-nitrophenol sodium salt, also known as Sodium 5-nitroguaiacol, is a chemical compound derived from the sodium nitrophenolate family. It is recognized for its significant role as a green food engineering plant growth regulator, as endorsed by the United Nations and the Food and Agriculture Organization (FAO). 2-Methoxy-5-nitrophenol sodium salt is characterized by its solubility in various organic solvents such as methanol, ethanol, and acetone, and its ability to be compounded with other sodium nitrophenolates to form sodium nitrophenolate, which finds broad applications in the agricultural sector.InChI:InChI=1/C7H7NO4.Na/c1-12-7-3-2-5(8(10)11)4-6(7)9;/h2-4,9H,1H3;/q;+1/p-1

Manufacturer supply top purity Compound Sodium Nitrophenolate 67233-85-6 with ISO standards

Product NameCompound Sodium Nitrophenolate
CasNo. 67233-85-6
MFC₇H₇NO₄·Na
MW191.119
Purity
Appearancered crystal
Packing
Contact usInquiry

Product Details

CasNo： 67233-85-6

MF： C₇H₇NO₄·Na

Appearance： red crystal